dehydrobruceine B

| Name | Dehydrobruceine B | ||
| PubChem CID | 101967133 | ||
| Molecular Weight | 478.4g/mol | ||
| Synonyms |
dehydrobruceine B |
||
| Formula | C₂₃H₂₆O₁₁ | ||
| SMILES | CC1=C2CC3C45COC(C4C(C(=O)O3)OC(=O)C)(C(C(C5C2(C=C(C1=O)O)C)O)O)C(=O)OC | ||
| InChI | 1S/C23H26O11/c1-8-10-5-12-22-7-32-23(20(30)31-4,17(22)15(19(29)34-12)33-9(2)24)18(28)14(27)16(22)21(10,3)6-11(25)13(8)26/h6,12,14-18,25,27-28H,5,7H2,1-4H3/t12-,14-,15-,16-,17-,18+,21+,22-,23+/m1/s1 | ||
| InChIKey | JXTROYJRNXSSKW-XUVISEOFSA-N | ||
| Structure |
Download
2D
MOL
3D
MOL
|
||
| Chineses Pinyin | YaDanZi | ||
| Use Part | Fruit | ||
| Habitat | FuJian, GuangXi, YunNan, TaiWan, GuangDong, FuJian, TaiWan | ||
| Flavor | Bitter | ||
| Meridian Tropism | Large intestine, Liver | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Sapindales
-->Family: Simaroubaceae
-->Genus: Brucea
-->Species: Brucea javanica
|
||
| Pair Name | Dehydrobruceine B, Cisplatin | |||
| Partner Name | Cisplatin | |||
| Disease Info | [ICD-11: 2C25.Z] | Lung cancer | Investigative | |
| Biological Phenomena | Induction-->Mitochondria-mediated apoptosis | |||
| Gene Regulation | Up-regulation | Expression | CYCS | hsa54205 |
| Up-regulation | Cleavage | AIFM1 | hsa9131 | |
| Down-regulation | Expression | BCL2 | hsa596 | |
| Up-regulation | Expression | BAX | hsa581 | |
| Up-regulation | Cleavage | CASP3 | hsa836 | |
| Up-regulation | Cleavage | CASP9 | hsa842 | |
| Up-regulation | Cleavage | PARP1 | hsa142 | |
| Down-regulation | Expression | NFE2L2 | hsa4780 | |
| Down-regulation | Expression | NQO1 | hsa1728 | |
| Down-regulation | Expression | ABCC1 | hsa4363 | |
| Down-regulation | Expression | ABCC2 | hsa1244 | |
| Down-regulation | Expression | GCLC | hsa2729 | |
| In Vitro Model | A-549 | Lung adenocarcinoma | Homo sapiens (Human) | CVCL_0023 |
| Result | These results generated a rationale for further investigation of DHB combined with CDDP as a potential therapeutic strategy in lung cancer. | |||